Display Settings:

Format
Items per page
Sort by

Send to:

Choose Destination

Results: 1 to 20 of 1923

1.
2.
an image of a chemical structure CID 69756496

AGN-PC-0IK6AW; SureCN6370600; N-(3-chloro-2-fluorophenyl)-7-methoxy-6-piperidin-1-yloxyquinazolin-4-amine

MW:
402.849803
g/mol
MF:
C20H20ClFN4O2
IUPAC name:
N-(3-chloro-2-fluorophenyl)-7-methoxy-6-piperidin-1-yloxyqui...
3.
an image of a chemical structure CID 68770814

AGN-PC-0I5QH5; N-(3-chloro-2-fluorophenyl)-6-methoxy-7-piperidin-1-yloxyquinazolin-4-amine

MW:
402.849803
g/mol
MF:
C20H20ClFN4O2
IUPAC name:
N-(3-chloro-2-fluorophenyl)-6-methoxy-7-piperidin-1-yloxyqui...
4.
an image of a chemical structure CID 74434805

AGN-PC-050NNK; N-(3-chloro-4-fluorophenyl)-7-methoxy-6-[3-[(3Z)-3-methoxyiminopiperidin-1-yl]propoxy]quinazolin-4-amine

MW:
487.954283
g/mol
MF:
C24H27ClFN5O3
IUPAC name:
N-(3-chloro-4-fluorophenyl)-7-methoxy-6-[3-(3-methoxyiminopi...
5.
an image of a chemical structure CID 71180468

AGN-PC-0J9RQV; SureCN14474871; N-(3-chloro-4-fluorophenyl)-6,7-dimethoxy-2-pyridin-3-ylquinazolin-4-amine

MW:
410.828743
g/mol
MF:
C21H16ClFN4O2
IUPAC name:
N-(3-chloro-4-fluorophenyl)-6,7-dimethoxy-2-pyridin-3-ylquin...
6.
7.
8.
9.
10.
11.
12.
13.
an image of a chemical structure CID 25253122

MW:
487.954283
g/mol
MF:
C24H27ClFN5O3
IUPAC name:
N-(3-chloro-4-fluorophenyl)-7-methoxy-6-[3-[(3Z)-3-methoxyim...
14.
an image of a chemical structure CID 25252965

AGN-PC-050NJG; N-(3-chloro-4-fluorophenyl)-7-methoxy-6-[3-(4-methoxyiminopiperidin-1-yl)propoxy]quinazolin-4-amine

MW:
487.954283
g/mol
MF:
C24H27ClFN5O3
IUPAC name:
N-(3-chloro-4-fluorophenyl)-7-methoxy-6-[3-(4-methoxyiminopi...
15.
16.
an image of a chemical structure CID 19077486

CHEMBL291514; SureCN11395; AGN-PC-023EXY ...

MW:
444.929543
g/mol
MF:
C23H26ClFN4O2
IUPAC name:
N-(3-chloro-4-fluorophenyl)-7-methoxy-6-(3-piperidin-1-ylpro...
17.
an image of a chemical structure CID 72544698

MW:
480.910470
g/mol
MF:
C23H24ClF3N4O2
IUPAC name:
N-(3-chloro-4-fluorophenyl)-6-[3-(4,4-difluoropiperidin-1-yl...
18.
an image of a chemical structure CID 72544697

MW:
462.920006
g/mol
MF:
C23H25ClF2N4O2
IUPAC name:
N-(3-chloro-4-fluorophenyl)-6-[3-(4-fluoropiperidin-1-yl)pro...
19.
an image of a chemical structure CID 72544475

MW:
470.966823
g/mol
MF:
C25H28ClFN4O2
IUPAC name:
N-(3-chloro-4-fluorophenyl)-6-[3-[(2S)-2-ethenylpiperidin-1-...
20.
an image of a chemical structure CID 72544473

MW:
472.982703
g/mol
MF:
C25H30ClFN4O2
IUPAC name:
N-(3-chloro-4-fluorophenyl)-6-[3-[(2R)-2-ethylpiperidin-1-yl...

Display Settings:

Format
Items per page
Sort by

Send to:

Choose Destination

Supplemental Content

Actions on your results

Refine your results

• What's this?

Find related data

Recent activity

Your browsing activity is empty.

Activity recording is turned off.

Turn recording back on

See more...
Write to the Help Desk