Display Settings:

Format
Items per page
Sort by

Send to:

Choose Destination

Results: 1 to 20 of 409

1.
an image of a chemical structure CID 53239958

GW445014X; CHEMBL1898784; NCGC00242019-01

MW:
307.174580
g/mol
MF:
C15H12Cl2N2O
IUPAC name:
5-[2-(2,6-dichlorophenyl)ethenyl]-N-methylpyridine-3-carboxa...
Create Date:
2011-07-08
2.
an image of a chemical structure CID 44418547

CHEMBL263796; GW445014X; HMS3303F10 ...

MW:
307.174580
g/mol
MF:
C15H12Cl2N2O
IUPAC name:
5-[(E)-2-(2,6-dichlorophenyl)ethenyl]-N-methylpyridine-3-car...
Create Date:
2009-11-19
3.
an image of a chemical structure CID 53239977

GW445017X; CHEMBL1868431; NCGC00242144-01

MW:
272.729520
g/mol
MF:
C15H13ClN2O
IUPAC name:
5-[2-(2-chlorophenyl)ethenyl]-N-methylpyridine-3-carboxamide
Create Date:
2011-07-08
4.
an image of a chemical structure CID 44418556

GW445017X; CHEMBL218970; HMS3303E19 ...

MW:
272.729520
g/mol
MF:
C15H13ClN2O
IUPAC name:
5-[(E)-2-(2-chlorophenyl)ethenyl]-N-methylpyridine-3-carboxa...
Create Date:
2009-11-19
5.
an image of a chemical structure CID 13227259
new record, indexing in progress
CID:
13227259
6.
an image of a chemical structure CID 421771

AC1L9LHP; 1-[(2,6-dichlorophenyl)methyl]-3-N,5-N-dimethylpyridin-1-ium-3,5-dicarboxamide

MW:
353.223140
g/mol
MF:
C16H16Cl2N3O2+
IUPAC name:
1-[(2,6-dichlorophenyl)methyl]-3-N,5-N-dimethylpyridin-1-ium...
Create Date:
2005-03-26
7.
an image of a chemical structure CID 26692391

AKOS005855800

MW:
315.582360
g/mol
MF:
C13H9Cl3N2O
IUPAC name:
5,6-dichloro-N-[(2-chlorophenyl)methyl]pyridine-3-carboxamid...
Create Date:
2009-05-28
8.
an image of a chemical structure CID 24411034

ARONIS26123; MolPort-006-362-611; STL256819 ...

MW:
281.137300
g/mol
MF:
C13H10Cl2N2O
IUPAC name:
N-[(2,4-dichlorophenyl)methyl]pyridine-3-carboxamide
Create Date:
2008-02-29
9.
an image of a chemical structure CID 24192369

NSC138473; NSC-138473; 40429-29-6

MW:
433.127140
g/mol
MF:
C16H16BrCl2N3O2
IUPAC name:
1-[(2,6-dichlorophenyl)methyl]-3-N,5-N-dimethylpyridin-1-ium...
Create Date:
2008-02-29
10.
an image of a chemical structure CID 21105073

SCHEMBL2854405

MW:
295.163880
g/mol
MF:
C14H12Cl2N2O
IUPAC name:
N-[2-(2,6-dichlorophenyl)ethyl]pyridine-3-carboxamide
Create Date:
2007-12-05
11.
an image of a chemical structure CID 11608789

MW:
274.745400
g/mol
MF:
C15H15ClN2O
IUPAC name:
N-[2-(2-chlorophenyl)ethyl]-5-methylpyridine-3-carboxamide
Create Date:
2006-10-26
12.
an image of a chemical structure CID 8088156

ST50846940; 6-chloro-N-[(2-chlorophenyl)methyl]pyridine-3-carboxamide; ZINC06829311 ...

MW:
281.137300
g/mol
MF:
C13H10Cl2N2O
IUPAC name:
6-chloro-N-[(2-chlorophenyl)methyl]pyridine-3-carboxamide
Create Date:
2006-07-30
13.
an image of a chemical structure CID 2707294

AC1MBI6E; PB-01290629; 6-chloro-N-[(2,4-dichlorophenyl)methyl]pyridine-3-carboxamide

MW:
315.582360
g/mol
MF:
C13H9Cl3N2O
IUPAC name:
6-chloro-N-[(2,4-dichlorophenyl)methyl]pyridine-3-carboxamid...
Create Date:
2005-07-16
14.
an image of a chemical structure CID 81226030

AKOS019797461

MW:
281.137300
g/mol
MF:
C13H10Cl2N2O
IUPAC name:
4-chloro-N-[(2-chlorophenyl)methyl]pyridine-3-carboxamide
Create Date:
2014-10-20
15.
an image of a chemical structure CID 61547237

AKOS010809438

MW:
299.754860
g/mol
MF:
C16H14ClN3O
IUPAC name:
5-(3-aminoprop-1-ynyl)-N-[(2-chlorophenyl)methyl]pyridine-3-...
Create Date:
2012-10-19
16.
an image of a chemical structure CID 39781692

MW:
267.110720
g/mol
MF:
C12H8Cl2N2O
IUPAC name:
5-(2,6-dichlorophenyl)pyridine-3-carboxamide
Create Date:
2009-05-29
17.
an image of a chemical structure CID 23271125

FHVRDWIJRLOWPC-UHFFFAOYSA-; InChI=1/C14H11Cl2N3O2/c15-11-2-1-3-12(16)10(11)7-19-5-8(13(17)20)4-9(6-19)14(18)21/h1-6H,7H2,(H3-,17,18,20,21)/p+1

MW:
325.169980
g/mol
MF:
C14H12Cl2N3O2+
IUPAC name:
1-[(2,6-dichlorophenyl)methyl]pyridin-1-ium-3,5-dicarboxamid...
Create Date:
2007-12-05
18.
an image of a chemical structure CID 22250915

SCHEMBL4041461; PKNYKRZMPCRCLS-UHFFFAOYSA-N; AKOS008914631 ...

MW:
329.608940
g/mol
MF:
C14H11Cl3N2O
IUPAC name:
6-chloro-N-[2-(2,4-dichlorophenyl)ethyl]pyridine-3-carboxami...
Create Date:
2007-12-05
19.
an image of a chemical structure CID 20117791

CTK6H3313; AKOS000155997; 2-Chloro-N-(2-chloro-benzyl)-nicotinamide ...

MW:
281.137300
g/mol
MF:
C13H10Cl2N2O
IUPAC name:
2-chloro-N-[(2-chlorophenyl)methyl]pyridine-3-carboxamide
Create Date:
2007-12-05
20.
an image of a chemical structure CID 17472910

MLS001150086; CHEMBL1710366; MolPort-004-602-620 ...

MW:
295.163880
g/mol
MF:
C14H12Cl2N2O
IUPAC name:
N-[2-(2,4-dichlorophenyl)ethyl]pyridine-3-carboxamide
Create Date:
2007-11-13

Display Settings:

Format
Items per page
Sort by

Send to:

Choose Destination

Supplemental Content

Actions on your results

Refine your results

• What's this?

Find related data

Recent activity

Your browsing activity is empty.

Activity recording is turned off.

Turn recording back on

See more...
Write to the Help Desk